C23H25BrClN3O4S — CID 141316341
N-[4-tert-butyl-5-[1-(4-chlorophenyl)-2-nitroethyl]-1,3-thiazol-2-yl]-2-methoxybenzamide;hydrobromide (PubChem CID 141316341) has the molecular formula C23H25BrClN3O4S and a molecular weight of 554.89 g/mol. Its IUPAC name is N-[4-tert-butyl-5-[1-(4-chlorophenyl)-2-nitroethyl]-1,3-thiazol-2-yl]-2-methoxybenzamide;hydrobromide.
| Compound Name | N-[4-tert-butyl-5-[1-(4-chlorophenyl)-2-nitroethyl]-1,3-thiazol-2-yl]-2-methoxybenzamide;hydrobromide |
|---|---|
| PubChem CID | 141316341 |
| Molecular Formula | C23H25BrClN3O4S |
| Molecular Weight | 554.89 g/mol |
| Exact Mass | 553.04 |
| IUPAC Name | N-[4-tert-butyl-5-[1-(4-chlorophenyl)-2-nitroethyl]-1,3-thiazol-2-yl]-2-methoxybenzamide;hydrobromide |
| SMILES | Br.COc1ccccc1C(=O)Nc1nc(C(C)(C)C)c(C(C[N+](=O)[O-])c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C23H24ClN3O4S.BrH/c1-23(2,3)20-19(17(13-27(29)30)14-9-11-15(24)12-10-14)32-22(25-20)26-21(28)16-7-5-6-8-18(16)31-4;/h5-12,17H,13H2,1-4H3,(H,25,26,28);1H |
| InChIKey | WLQVDLGVLOWMPC-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.89 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|