C23H22N6O3S — CID 43837240
1-(3,4-dimethylphenyl)-5-methyl-N-[4-methyl-5-[(3-nitrophenyl)methyl]-1,3-thiazol-2-yl]triazole-4-carboxamide (PubChem CID 43837240) has the molecular formula C23H22N6O3S and a molecular weight of 462.54 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-5-methyl-N-[4-methyl-5-[(3-nitrophenyl)methyl]-1,3-thiazol-2-yl]triazole-4-carboxamide.
| Compound Name | 1-(3,4-dimethylphenyl)-5-methyl-N-[4-methyl-5-[(3-nitrophenyl)methyl]-1,3-thiazol-2-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 43837240 |
| Molecular Formula | C23H22N6O3S |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-5-methyl-N-[4-methyl-5-[(3-nitrophenyl)methyl]-1,3-thiazol-2-yl]triazole-4-carboxamide |
| SMILES | Cc1ccc(-n2nnc(C(=O)Nc3nc(C)c(Cc4cccc([N+](=O)[O-])c4)s3)c2C)cc1C |
| InChI | InChI=1S/C23H22N6O3S/c1-13-8-9-18(10-14(13)2)28-16(4)21(26-27-28)22(30)25-23-24-15(3)20(33-23)12-17-6-5-7-19(11-17)29(31)32/h5-11H,12H2,1-4H3,(H,24,25,30) |
| InChIKey | WZWVYQNABMUROP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|