C11H8ClNO3 — CID 4961939
2-(4-chlorophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid (PubChem CID 4961939) has the molecular formula C11H8ClNO3 and a molecular weight of 237.64 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-(4-chlorophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 4961939 |
| Molecular Formula | C11H8ClNO3 |
| Molecular Weight | 237.64 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 2-(4-chlorophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid |
| SMILES | Cc1oc(-c2ccc(Cl)cc2)nc1C(=O)O |
| InChI | InChI=1S/C11H8ClNO3/c1-6-9(11(14)15)13-10(16-6)7-2-4-8(12)5-3-7/h2-5H,1H3,(H,14,15) |
| InChIKey | VKGNZWBREYZBKG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.64 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |