C11H7Br2NO3 — CID 107974660
2-(3,5-dibromophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid (PubChem CID 107974660) has the molecular formula C11H7Br2NO3 and a molecular weight of 360.99 g/mol. Its IUPAC name is 2-(3,5-dibromophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-(3,5-dibromophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107974660 |
| Molecular Formula | C11H7Br2NO3 |
| Molecular Weight | 360.99 g/mol |
| Exact Mass | 358.88 |
| IUPAC Name | 2-(3,5-dibromophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid |
| SMILES | Cc1oc(-c2cc(Br)cc(Br)c2)nc1C(=O)O |
| InChI | InChI=1S/C11H7Br2NO3/c1-5-9(11(15)16)14-10(17-5)6-2-7(12)4-8(13)3-6/h2-4H,1H3,(H,15,16) |
| InChIKey | SJPUXPYLBDRMRE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.99 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |