C18H19ClN2O3 — CID 95581186
[(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methanone (PubChem CID 95581186) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is [(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methanone.
| Compound Name | [(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methanone |
|---|---|
| PubChem CID | 95581186 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | [(4aR,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methanone |
| SMILES | Cc1oc(-c2ccc(Cl)cc2)nc1C(=O)N1CCO[C@@H]2CCC[C@H]21 |
| InChI | InChI=1S/C18H19ClN2O3/c1-11-16(20-17(24-11)12-5-7-13(19)8-6-12)18(22)21-9-10-23-15-4-2-3-14(15)21/h5-8,14-15H,2-4,9-10H2,1H3/t14-,15-/m1/s1 |
| InChIKey | AJVPPEVMWWGLIY-HUUCEWRRSA-N |
| XLogP | 3.70 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |