C12H9BrClNO2 — CID 86674821
2-bromo-1-[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]ethanone (PubChem CID 86674821) has the molecular formula C12H9BrClNO2 and a molecular weight of 314.57 g/mol. Its IUPAC name is 2-bromo-1-[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]ethanone.
| Compound Name | 2-bromo-1-[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]ethanone |
|---|---|
| PubChem CID | 86674821 |
| Molecular Formula | C12H9BrClNO2 |
| Molecular Weight | 314.57 g/mol |
| Exact Mass | 312.95 |
| IUPAC Name | 2-bromo-1-[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]ethanone |
| SMILES | Cc1oc(-c2ccc(Cl)cc2)nc1C(=O)CBr |
| InChI | InChI=1S/C12H9BrClNO2/c1-7-11(10(16)6-13)15-12(17-7)8-2-4-9(14)5-3-8/h2-5H,6H2,1H3 |
| InChIKey | WDRZHURZKPAQTI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|