C17H10N2O5 — CID 95911828
prop-2-ynyl 3-(6-nitro-1,3-benzoxazol-2-yl)benzoate (PubChem CID 95911828) has the molecular formula C17H10N2O5 and a molecular weight of 322.28 g/mol. Its IUPAC name is prop-2-ynyl 3-(6-nitro-1,3-benzoxazol-2-yl)benzoate.
| Compound Name | prop-2-ynyl 3-(6-nitro-1,3-benzoxazol-2-yl)benzoate |
|---|---|
| PubChem CID | 95911828 |
| Molecular Formula | C17H10N2O5 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | prop-2-ynyl 3-(6-nitro-1,3-benzoxazol-2-yl)benzoate |
| SMILES | C#CCOC(=O)c1cccc(-c2nc3ccc([N+](=O)[O-])cc3o2)c1 |
| InChI | InChI=1S/C17H10N2O5/c1-2-8-23-17(20)12-5-3-4-11(9-12)16-18-14-7-6-13(19(21)22)10-15(14)24-16/h1,3-7,9-10H,8H2 |
| InChIKey | UWCZWRWMLWYJPW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|