C15H11FN2O2 — CID 94979202
1-[5-amino-2-(3-fluorophenyl)-1,3-benzoxazol-7-yl]ethanone (PubChem CID 94979202) has the molecular formula C15H11FN2O2 and a molecular weight of 270.26 g/mol. Its IUPAC name is 1-[5-amino-2-(3-fluorophenyl)-1,3-benzoxazol-7-yl]ethanone.
| Compound Name | 1-[5-amino-2-(3-fluorophenyl)-1,3-benzoxazol-7-yl]ethanone |
|---|---|
| PubChem CID | 94979202 |
| Molecular Formula | C15H11FN2O2 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 1-[5-amino-2-(3-fluorophenyl)-1,3-benzoxazol-7-yl]ethanone |
| SMILES | CC(=O)c1cc(N)cc2nc(-c3cccc(F)c3)oc12 |
| InChI | InChI=1S/C15H11FN2O2/c1-8(19)12-6-11(17)7-13-14(12)20-15(18-13)9-3-2-4-10(16)5-9/h2-7H,17H2,1H3 |
| InChIKey | QCKGUTARVWRWGR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|