C14H10BrN3O2 — CID 95911730
5-amino-2-(3-bromophenyl)-1,3-benzoxazole-7-carboxamide (PubChem CID 95911730) has the molecular formula C14H10BrN3O2 and a molecular weight of 332.16 g/mol. Its IUPAC name is 5-amino-2-(3-bromophenyl)-1,3-benzoxazole-7-carboxamide.
| Compound Name | 5-amino-2-(3-bromophenyl)-1,3-benzoxazole-7-carboxamide |
|---|---|
| PubChem CID | 95911730 |
| Molecular Formula | C14H10BrN3O2 |
| Molecular Weight | 332.16 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 5-amino-2-(3-bromophenyl)-1,3-benzoxazole-7-carboxamide |
| SMILES | NC(=O)c1cc(N)cc2nc(-c3cccc(Br)c3)oc12 |
| InChI | InChI=1S/C14H10BrN3O2/c15-8-3-1-2-7(4-8)14-18-11-6-9(16)5-10(13(17)19)12(11)20-14/h1-6H,16H2,(H2,17,19) |
| InChIKey | VNCAPGZGAGHSKF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.16 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|