About CID 89035769
CID 89035769 (PubChem CID 89035769) has the molecular formula C13H7BBrNO
and a molecular weight of 283.92 g/mol.
Molecular Properties
| Compound Name | CID 89035769 |
| PubChem CID | 89035769 |
| Molecular Formula | C13H7BBrNO |
| Molecular Weight | 283.92 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2oc(-c3ccc(Br)cc3)nc2c1 |
| InChI | InChI=1S/C13H7BBrNO/c14-9-3-6-12-11(7-9)16-13(17-12)8-1-4-10(15)5-2-8/h1-7H |
| InChIKey | HNLYXVHVQHRWNM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.92 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89035769 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89035769?
The IUPAC name of CID 89035769 (CID 89035769) is not available.
What is the SMILES notation for CID 89035769?
The canonical SMILES for CID 89035769 is [B]c1ccc2oc(-c3ccc(Br)cc3)nc2c1.
What is the InChIKey of CID 89035769?
The InChIKey is HNLYXVHVQHRWNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7BBrNO/c14-9-3-6-12-11(7-9)16-13(17-12)8-1-4-10(15)5-2-8/h1-7H.
What are the key properties of CID 89035769?
CID 89035769 has a molecular weight of 283.92 g/mol, XLogP of 3.05, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89035769 is sourced from PubChem (CID 89035769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).