C8H6NO3S- — CID 20632666
2-methyl-1,3-benzoxazole-6-sulfinate (PubChem CID 20632666) has the molecular formula C8H6NO3S- and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-methyl-1,3-benzoxazole-6-sulfinate.
| Compound Name | 2-methyl-1,3-benzoxazole-6-sulfinate |
|---|---|
| PubChem CID | 20632666 |
| Molecular Formula | C8H6NO3S- |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | 2-methyl-1,3-benzoxazole-6-sulfinate |
| SMILES | Cc1nc2ccc(S(=O)[O-])cc2o1 |
| InChI | InChI=1S/C8H7NO3S/c1-5-9-7-3-2-6(13(10)11)4-8(7)12-5/h2-4H,1H3,(H,10,11)/p-1 |
| InChIKey | RQLQPXVXAGGFEN-UHFFFAOYSA-M |
| XLogP | 1.37 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|