C13H13N3O2 — CID 116831941
5-ethyl-4-(2-methyl-1,3-benzoxazol-6-yl)-1,3-oxazol-2-amine (PubChem CID 116831941) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 5-ethyl-4-(2-methyl-1,3-benzoxazol-6-yl)-1,3-oxazol-2-amine.
| Compound Name | 5-ethyl-4-(2-methyl-1,3-benzoxazol-6-yl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 116831941 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 5-ethyl-4-(2-methyl-1,3-benzoxazol-6-yl)-1,3-oxazol-2-amine |
| SMILES | CCc1oc(N)nc1-c1ccc2nc(C)oc2c1 |
| InChI | InChI=1S/C13H13N3O2/c1-3-10-12(16-13(14)18-10)8-4-5-9-11(6-8)17-7(2)15-9/h4-6H,3H2,1-2H3,(H2,14,16) |
| InChIKey | FGDOCCNCPISTNN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |