C16H22N2O — CID 116831894
4-(5-tert-butyl-2-methylphenyl)-5-ethyl-1,3-oxazol-2-amine (PubChem CID 116831894) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 4-(5-tert-butyl-2-methylphenyl)-5-ethyl-1,3-oxazol-2-amine.
| Compound Name | 4-(5-tert-butyl-2-methylphenyl)-5-ethyl-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 116831894 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 4-(5-tert-butyl-2-methylphenyl)-5-ethyl-1,3-oxazol-2-amine |
| SMILES | CCc1oc(N)nc1-c1cc(C(C)(C)C)ccc1C |
| InChI | InChI=1S/C16H22N2O/c1-6-13-14(18-15(17)19-13)12-9-11(16(3,4)5)8-7-10(12)2/h7-9H,6H2,1-5H3,(H2,17,18) |
| InChIKey | VUQZFIWCGJBQLY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |