C13H15FN2O2 — CID 116831911
4-(4-ethoxy-3-fluorophenyl)-5-ethyl-1,3-oxazol-2-amine (PubChem CID 116831911) has the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. Its IUPAC name is 4-(4-ethoxy-3-fluorophenyl)-5-ethyl-1,3-oxazol-2-amine.
| Compound Name | 4-(4-ethoxy-3-fluorophenyl)-5-ethyl-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 116831911 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 4-(4-ethoxy-3-fluorophenyl)-5-ethyl-1,3-oxazol-2-amine |
| SMILES | CCOc1ccc(-c2nc(N)oc2CC)cc1F |
| InChI | InChI=1S/C13H15FN2O2/c1-3-10-12(16-13(15)18-10)8-5-6-11(17-4-2)9(14)7-8/h5-7H,3-4H2,1-2H3,(H2,15,16) |
| InChIKey | ROZJAJARIUVNAD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |