C17H17FN4O — CID 142578077
4-(4-ethoxy-3-fluorophenyl)-5-(2-methyl-4-pyridinyl)-1H-imidazol-2-amine (PubChem CID 142578077) has the molecular formula C17H17FN4O and a molecular weight of 312.35 g/mol. Its IUPAC name is 4-(4-ethoxy-3-fluorophenyl)-5-(2-methyl-4-pyridinyl)-1H-imidazol-2-amine.
| Compound Name | 4-(4-ethoxy-3-fluorophenyl)-5-(2-methyl-4-pyridinyl)-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 142578077 |
| Molecular Formula | C17H17FN4O |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 4-(4-ethoxy-3-fluorophenyl)-5-(2-methyl-4-pyridinyl)-1H-imidazol-2-amine |
| SMILES | CCOc1ccc(-c2nc(N)[nH]c2-c2ccnc(C)c2)cc1F |
| InChI | InChI=1S/C17H17FN4O/c1-3-23-14-5-4-11(9-13(14)18)15-16(22-17(19)21-15)12-6-7-20-10(2)8-12/h4-9H,3H2,1-2H3,(H3,19,21,22) |
| InChIKey | KVPIRKRVUVAKMU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |