C13H13FN2O3 — CID 82303643
4-amino-2-(4-ethoxy-3-fluorophenyl)-1H-pyrrole-3-carboxylic acid (PubChem CID 82303643) has the molecular formula C13H13FN2O3 and a molecular weight of 264.26 g/mol. Its IUPAC name is 4-amino-2-(4-ethoxy-3-fluorophenyl)-1H-pyrrole-3-carboxylic acid.
| Compound Name | 4-amino-2-(4-ethoxy-3-fluorophenyl)-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 82303643 |
| Molecular Formula | C13H13FN2O3 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 4-amino-2-(4-ethoxy-3-fluorophenyl)-1H-pyrrole-3-carboxylic acid |
| SMILES | CCOc1ccc(-c2[nH]cc(N)c2C(=O)O)cc1F |
| InChI | InChI=1S/C13H13FN2O3/c1-2-19-10-4-3-7(5-8(10)14)12-11(13(17)18)9(15)6-16-12/h3-6,16H,2,15H2,1H3,(H,17,18) |
| InChIKey | UTIOMFMLJJAINV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |