C8H6ClN3O — CID 166610755
5-(2-chloropyrimidin-4-yl)-2-methyl-1,3-oxazole (PubChem CID 166610755) has the molecular formula C8H6ClN3O and a molecular weight of 195.61 g/mol. Its IUPAC name is 5-(2-chloropyrimidin-4-yl)-2-methyl-1,3-oxazole.
| Compound Name | 5-(2-chloropyrimidin-4-yl)-2-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 166610755 |
| Molecular Formula | C8H6ClN3O |
| Molecular Weight | 195.61 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | 5-(2-chloropyrimidin-4-yl)-2-methyl-1,3-oxazole |
| SMILES | Cc1ncc(-c2ccnc(Cl)n2)o1 |
| InChI | InChI=1S/C8H6ClN3O/c1-5-11-4-7(13-5)6-2-3-10-8(9)12-6/h2-4H,1H3 |
| InChIKey | USUPISONTAJBMJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.61 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |