C15H18N4S — CID 106849612
[6-cyclopropyl-2-(4-ethylsulfanylphenyl)pyrimidin-4-yl]hydrazine (PubChem CID 106849612) has the molecular formula C15H18N4S and a molecular weight of 286.40 g/mol. Its IUPAC name is [6-cyclopropyl-2-(4-ethylsulfanylphenyl)pyrimidin-4-yl]hydrazine.
| Compound Name | [6-cyclopropyl-2-(4-ethylsulfanylphenyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 106849612 |
| Molecular Formula | C15H18N4S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | [6-cyclopropyl-2-(4-ethylsulfanylphenyl)pyrimidin-4-yl]hydrazine |
| SMILES | CCSc1ccc(-c2nc(NN)cc(C3CC3)n2)cc1 |
| InChI | InChI=1S/C15H18N4S/c1-2-20-12-7-5-11(6-8-12)15-17-13(10-3-4-10)9-14(18-15)19-16/h5-10H,2-4,16H2,1H3,(H,17,18,19) |
| InChIKey | YQYVSKSBWFUQOC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|