C14H15FN4 — CID 63354408
[6-cyclopropyl-2-(4-fluoro-3-methylphenyl)pyrimidin-4-yl]hydrazine (PubChem CID 63354408) has the molecular formula C14H15FN4 and a molecular weight of 258.30 g/mol. Its IUPAC name is [6-cyclopropyl-2-(4-fluoro-3-methylphenyl)pyrimidin-4-yl]hydrazine.
| Compound Name | [6-cyclopropyl-2-(4-fluoro-3-methylphenyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 63354408 |
| Molecular Formula | C14H15FN4 |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | [6-cyclopropyl-2-(4-fluoro-3-methylphenyl)pyrimidin-4-yl]hydrazine |
| SMILES | Cc1cc(-c2nc(NN)cc(C3CC3)n2)ccc1F |
| InChI | InChI=1S/C14H15FN4/c1-8-6-10(4-5-11(8)15)14-17-12(9-2-3-9)7-13(18-14)19-16/h4-7,9H,2-3,16H2,1H3,(H,17,18,19) |
| InChIKey | WLUFDFQWOYNWKJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|