C16H17F2N3 — CID 63354131
6-cyclopropyl-2-(3,4-difluorophenyl)-N-propylpyrimidin-4-amine (PubChem CID 63354131) has the molecular formula C16H17F2N3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 6-cyclopropyl-2-(3,4-difluorophenyl)-N-propylpyrimidin-4-amine.
| Compound Name | 6-cyclopropyl-2-(3,4-difluorophenyl)-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 63354131 |
| Molecular Formula | C16H17F2N3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 6-cyclopropyl-2-(3,4-difluorophenyl)-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1cc(C2CC2)nc(-c2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C16H17F2N3/c1-2-7-19-15-9-14(10-3-4-10)20-16(21-15)11-5-6-12(17)13(18)8-11/h5-6,8-10H,2-4,7H2,1H3,(H,19,20,21) |
| InChIKey | CEUWCRRLADLUNF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |