C16H19N3O — CID 63354599
3-[4-cyclopropyl-6-(propylamino)pyrimidin-2-yl]phenol (PubChem CID 63354599) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 3-[4-cyclopropyl-6-(propylamino)pyrimidin-2-yl]phenol.
| Compound Name | 3-[4-cyclopropyl-6-(propylamino)pyrimidin-2-yl]phenol |
|---|---|
| PubChem CID | 63354599 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 3-[4-cyclopropyl-6-(propylamino)pyrimidin-2-yl]phenol |
| SMILES | CCCNc1cc(C2CC2)nc(-c2cccc(O)c2)n1 |
| InChI | InChI=1S/C16H19N3O/c1-2-8-17-15-10-14(11-6-7-11)18-16(19-15)12-4-3-5-13(20)9-12/h3-5,9-11,20H,2,6-8H2,1H3,(H,17,18,19) |
| InChIKey | KTZRWGPBVJOJIA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |