C14H16N4O — CID 55189800
[6-cyclopropyl-2-(3-methoxyphenyl)pyrimidin-4-yl]hydrazine (PubChem CID 55189800) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is [6-cyclopropyl-2-(3-methoxyphenyl)pyrimidin-4-yl]hydrazine.
| Compound Name | [6-cyclopropyl-2-(3-methoxyphenyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 55189800 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | [6-cyclopropyl-2-(3-methoxyphenyl)pyrimidin-4-yl]hydrazine |
| SMILES | COc1cccc(-c2nc(NN)cc(C3CC3)n2)c1 |
| InChI | InChI=1S/C14H16N4O/c1-19-11-4-2-3-10(7-11)14-16-12(9-5-6-9)8-13(17-14)18-15/h2-4,7-9H,5-6,15H2,1H3,(H,16,17,18) |
| InChIKey | QRPKVNVUSYGVBV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|