C13H13N3S2 — CID 98019570
3-(4-ethylsulfanylphenyl)imidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 98019570) has the molecular formula C13H13N3S2 and a molecular weight of 275.40 g/mol. Its IUPAC name is 3-(4-ethylsulfanylphenyl)imidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | 3-(4-ethylsulfanylphenyl)imidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 98019570 |
| Molecular Formula | C13H13N3S2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 3-(4-ethylsulfanylphenyl)imidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | CCSc1ccc(-c2csc3nc(N)cn23)cc1 |
| InChI | InChI=1S/C13H13N3S2/c1-2-17-10-5-3-9(4-6-10)11-8-18-13-15-12(14)7-16(11)13/h3-8H,2,14H2,1H3 |
| InChIKey | OLYOMHWFIYJHIP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |