C15H16N2O2S — CID 82062007
[3-(4-propoxyphenyl)imidazo[2,1-b][1,3]thiazol-6-yl]methanol (PubChem CID 82062007) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is [3-(4-propoxyphenyl)imidazo[2,1-b][1,3]thiazol-6-yl]methanol.
| Compound Name | [3-(4-propoxyphenyl)imidazo[2,1-b][1,3]thiazol-6-yl]methanol |
|---|---|
| PubChem CID | 82062007 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | [3-(4-propoxyphenyl)imidazo[2,1-b][1,3]thiazol-6-yl]methanol |
| SMILES | CCCOc1ccc(-c2csc3nc(CO)cn23)cc1 |
| InChI | InChI=1S/C15H16N2O2S/c1-2-7-19-13-5-3-11(4-6-13)14-10-20-15-16-12(9-18)8-17(14)15/h3-6,8,10,18H,2,7,9H2,1H3 |
| InChIKey | FFWAPUFGOUKUDC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |