C13H15NOS2 — CID 116969974
4-(4-ethylsulfanylphenyl)-2-(methoxymethyl)-1,3-thiazole (PubChem CID 116969974) has the molecular formula C13H15NOS2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 4-(4-ethylsulfanylphenyl)-2-(methoxymethyl)-1,3-thiazole.
| Compound Name | 4-(4-ethylsulfanylphenyl)-2-(methoxymethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 116969974 |
| Molecular Formula | C13H15NOS2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 4-(4-ethylsulfanylphenyl)-2-(methoxymethyl)-1,3-thiazole |
| SMILES | CCSc1ccc(-c2csc(COC)n2)cc1 |
| InChI | InChI=1S/C13H15NOS2/c1-3-16-11-6-4-10(5-7-11)12-9-17-13(14-12)8-15-2/h4-7,9H,3,8H2,1-2H3 |
| InChIKey | WUGQULRTJYYKQH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |