C13H13NO4S2 — CID 4269847
2-[4-(4-ethylsulfonylphenyl)-1,3-thiazol-2-yl]acetic acid (PubChem CID 4269847) has the molecular formula C13H13NO4S2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-[4-(4-ethylsulfonylphenyl)-1,3-thiazol-2-yl]acetic acid.
| Compound Name | 2-[4-(4-ethylsulfonylphenyl)-1,3-thiazol-2-yl]acetic acid |
|---|---|
| PubChem CID | 4269847 |
| Molecular Formula | C13H13NO4S2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 2-[4-(4-ethylsulfonylphenyl)-1,3-thiazol-2-yl]acetic acid |
| SMILES | CCS(=O)(=O)c1ccc(-c2csc(CC(=O)O)n2)cc1 |
| InChI | InChI=1S/C13H13NO4S2/c1-2-20(17,18)10-5-3-9(4-6-10)11-8-19-12(14-11)7-13(15)16/h3-6,8H,2,7H2,1H3,(H,15,16) |
| InChIKey | LWCRSQXZINCXHD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |