C13H12N2O5S — CID 4036294
2-[4-(4-ethoxy-3-nitrophenyl)-1,3-thiazol-2-yl]acetic acid (PubChem CID 4036294) has the molecular formula C13H12N2O5S and a molecular weight of 308.32 g/mol. Its IUPAC name is 2-[4-(4-ethoxy-3-nitrophenyl)-1,3-thiazol-2-yl]acetic acid.
| Compound Name | 2-[4-(4-ethoxy-3-nitrophenyl)-1,3-thiazol-2-yl]acetic acid |
|---|---|
| PubChem CID | 4036294 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 2-[4-(4-ethoxy-3-nitrophenyl)-1,3-thiazol-2-yl]acetic acid |
| SMILES | CCOc1ccc(-c2csc(CC(=O)O)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12N2O5S/c1-2-20-11-4-3-8(5-10(11)15(18)19)9-7-21-12(14-9)6-13(16)17/h3-5,7H,2,6H2,1H3,(H,16,17) |
| InChIKey | FHZFLYCGXNHRNA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|