C31H30N2O3S — CID 23023955
4-[2-[4-[4-[(4-cyclohexylbenzoyl)amino]phenyl]-1,3-thiazol-2-yl]ethyl]benzoic acid (PubChem CID 23023955) has the molecular formula C31H30N2O3S and a molecular weight of 510.66 g/mol. Its IUPAC name is 4-[2-[4-[4-[(4-cyclohexylbenzoyl)amino]phenyl]-1,3-thiazol-2-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[4-[4-[(4-cyclohexylbenzoyl)amino]phenyl]-1,3-thiazol-2-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 23023955 |
| Molecular Formula | C31H30N2O3S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 4-[2-[4-[4-[(4-cyclohexylbenzoyl)amino]phenyl]-1,3-thiazol-2-yl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCc2nc(-c3ccc(NC(=O)c4ccc(C5CCCCC5)cc4)cc3)cs2)cc1 |
| InChI | InChI=1S/C31H30N2O3S/c34-30(25-13-11-23(12-14-25)22-4-2-1-3-5-22)32-27-17-15-24(16-18-27)28-20-37-29(33-28)19-8-21-6-9-26(10-7-21)31(35)36/h6-7,9-18,20,22H,1-5,8,19H2,(H,32,34)(H,35,36) |
| InChIKey | WLFWCACMYKDAKX-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |