C19H16N2OS — CID 35619010
N-[4-(2-cyclopropyl-1,3-thiazol-4-yl)phenyl]benzamide (PubChem CID 35619010) has the molecular formula C19H16N2OS and a molecular weight of 320.42 g/mol. Its IUPAC name is N-[4-(2-cyclopropyl-1,3-thiazol-4-yl)phenyl]benzamide.
| Compound Name | N-[4-(2-cyclopropyl-1,3-thiazol-4-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 35619010 |
| Molecular Formula | C19H16N2OS |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-[4-(2-cyclopropyl-1,3-thiazol-4-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2csc(C3CC3)n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H16N2OS/c22-18(14-4-2-1-3-5-14)20-16-10-8-13(9-11-16)17-12-23-19(21-17)15-6-7-15/h1-5,8-12,15H,6-7H2,(H,20,22) |
| InChIKey | VUDVHTVHFLWHPF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |