C21H20N2O2S — CID 46394880
4-(2-cyclopropyl-1,3-thiazol-4-yl)-N-(4-ethoxyphenyl)benzamide (PubChem CID 46394880) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is 4-(2-cyclopropyl-1,3-thiazol-4-yl)-N-(4-ethoxyphenyl)benzamide.
| Compound Name | 4-(2-cyclopropyl-1,3-thiazol-4-yl)-N-(4-ethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 46394880 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 4-(2-cyclopropyl-1,3-thiazol-4-yl)-N-(4-ethoxyphenyl)benzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(-c3csc(C4CC4)n3)cc2)cc1 |
| InChI | InChI=1S/C21H20N2O2S/c1-2-25-18-11-9-17(10-12-18)22-20(24)15-5-3-14(4-6-15)19-13-26-21(23-19)16-7-8-16/h3-6,9-13,16H,2,7-8H2,1H3,(H,22,24) |
| InChIKey | QQKPMWGOAWZAIA-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |