C18H19NO4 — CID 5028165
4-(2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinolin-6-yl)-2-methoxyphenol (PubChem CID 5028165) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 4-(2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinolin-6-yl)-2-methoxyphenol.
| Compound Name | 4-(2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinolin-6-yl)-2-methoxyphenol |
|---|---|
| PubChem CID | 5028165 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 4-(2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinolin-6-yl)-2-methoxyphenol |
| SMILES | COc1cc(C2NCCc3cc4c(cc32)OCCO4)ccc1O |
| InChI | InChI=1S/C18H19NO4/c1-21-15-9-12(2-3-14(15)20)18-13-10-17-16(22-6-7-23-17)8-11(13)4-5-19-18/h2-3,8-10,18-20H,4-7H2,1H3 |
| InChIKey | KWVHMHMHOGFAHR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |