C12H16NO3+ — CID 22759802
6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-8-ol (PubChem CID 22759802) has the molecular formula C12H16NO3+ and a molecular weight of 222.26 g/mol. Its IUPAC name is 6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-8-ol.
| Compound Name | 6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-8-ol |
|---|---|
| PubChem CID | 22759802 |
| Molecular Formula | C12H16NO3+ |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-8-ol |
| SMILES | C[N+]1(C)Cc2cc3c(cc2C(O)C1)OCO3 |
| InChI | InChI=1S/C12H16NO3/c1-13(2)5-8-3-11-12(16-7-15-11)4-9(8)10(14)6-13/h3-4,10,14H,5-7H2,1-2H3/q+1 |
| InChIKey | IXKUBIOSOQSHBG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|