C21H24NO4+ — CID 162807653
(1R,12R)-15,16-dimethoxy-20,20-dimethyl-5,7-dioxa-20-azoniapentacyclo[10.6.2.02,10.04,8.013,18]icosa-2,4(8),9,13,15,17-hexaene (PubChem CID 162807653) has the molecular formula C21H24NO4+ and a molecular weight of 354.43 g/mol. Its IUPAC name is (1R,12R)-15,16-dimethoxy-20,20-dimethyl-5,7-dioxa-20-azoniapentacyclo[10.6.2.02,10.04,8.013,18]icosa-2,4(8),9,13,15,17-hexaene.
| Compound Name | (1R,12R)-15,16-dimethoxy-20,20-dimethyl-5,7-dioxa-20-azoniapentacyclo[10.6.2.02,10.04,8.013,18]icosa-2,4(8),9,13,15,17-hexaene |
|---|---|
| PubChem CID | 162807653 |
| Molecular Formula | C21H24NO4+ |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (1R,12R)-15,16-dimethoxy-20,20-dimethyl-5,7-dioxa-20-azoniapentacyclo[10.6.2.02,10.04,8.013,18]icosa-2,4(8),9,13,15,17-hexaene |
| SMILES | COc1cc2c(cc1OC)[C@H]1Cc3cc4c(cc3[C@H]2C[N+]1(C)C)OCO4 |
| InChI | InChI=1S/C21H24NO4/c1-22(2)10-16-13-7-21-20(25-11-26-21)6-12(13)5-17(22)15-9-19(24-4)18(23-3)8-14(15)16/h6-9,16-17H,5,10-11H2,1-4H3/q+1/t16-,17-/m1/s1 |
| InChIKey | OFBZWQTVLBOVRT-IAGOWNOFSA-N |
| XLogP | 3.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|