C21H24NO4+ — CID 11653279
(1S,12S)-14,15-dimethoxy-20,20-dimethyl-5,7-dioxa-20-azoniapentacyclo[10.7.1.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaene (PubChem CID 11653279) has the molecular formula C21H24NO4+ and a molecular weight of 354.43 g/mol. Its IUPAC name is (1S,12S)-14,15-dimethoxy-20,20-dimethyl-5,7-dioxa-20-azoniapentacyclo[10.7.1.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaene.
| Compound Name | (1S,12S)-14,15-dimethoxy-20,20-dimethyl-5,7-dioxa-20-azoniapentacyclo[10.7.1.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaene |
|---|---|
| PubChem CID | 11653279 |
| Molecular Formula | C21H24NO4+ |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (1S,12S)-14,15-dimethoxy-20,20-dimethyl-5,7-dioxa-20-azoniapentacyclo[10.7.1.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaene |
| SMILES | COc1ccc2c(c1OC)[C@@H]1Cc3cc4c(cc3[C@H](C2)[N+]1(C)C)OCO4 |
| InChI | InChI=1S/C21H24NO4/c1-22(2)15-7-12-5-6-17(23-3)21(24-4)20(12)16(22)8-13-9-18-19(10-14(13)15)26-11-25-18/h5-6,9-10,15-16H,7-8,11H2,1-4H3/q+1/t15-,16-/m0/s1 |
| InChIKey | YGDGISBZNBVRHP-HOTGVXAUSA-N |
| XLogP | 3.40 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|