C20H24NO4+ — CID 163008475
5-[[(5R)-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]methyl]-2-methoxyphenol (PubChem CID 163008475) has the molecular formula C20H24NO4+ and a molecular weight of 342.42 g/mol. Its IUPAC name is 5-[[(5R)-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]methyl]-2-methoxyphenol.
| Compound Name | 5-[[(5R)-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 163008475 |
| Molecular Formula | C20H24NO4+ |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 5-[[(5R)-6,6-dimethyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]methyl]-2-methoxyphenol |
| SMILES | COc1ccc(C[C@@H]2c3cc4c(cc3CC[N+]2(C)C)OCO4)cc1O |
| InChI | InChI=1S/C20H23NO4/c1-21(2)7-6-14-10-19-20(25-12-24-19)11-15(14)16(21)8-13-4-5-18(23-3)17(22)9-13/h4-5,9-11,16H,6-8,12H2,1-3H3/p+1/t16-/m1/s1 |
| InChIKey | UWJDPLOJHYXDPK-MRXNPFEDSA-O |
| XLogP | 3.05 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|