C20H26NO3+ — CID 50917753
2-methoxy-5-[[(1S)-6-methoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-1-yl]methyl]phenol (PubChem CID 50917753) has the molecular formula C20H26NO3+ and a molecular weight of 328.43 g/mol. Its IUPAC name is 2-methoxy-5-[[(1S)-6-methoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-1-yl]methyl]phenol.
| Compound Name | 2-methoxy-5-[[(1S)-6-methoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 50917753 |
| Molecular Formula | C20H26NO3+ |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 2-methoxy-5-[[(1S)-6-methoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-1-yl]methyl]phenol |
| SMILES | COc1ccc2c(c1)CC[N+](C)(C)[C@H]2Cc1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C20H25NO3/c1-21(2)10-9-15-13-16(23-3)6-7-17(15)18(21)11-14-5-8-20(24-4)19(22)12-14/h5-8,12-13,18H,9-11H2,1-4H3/p+1/t18-/m0/s1 |
| InChIKey | WJAXYUBCWFGBKL-SFHVURJKSA-O |
| XLogP | 3.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|