C20H26INO3 — CID 52993803
4-[[(1R)-6,7-dimethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-1-yl]methyl]phenolate;hydroiodide (PubChem CID 52993803) has the molecular formula C20H26INO3 and a molecular weight of 455.34 g/mol. Its IUPAC name is 4-[[(1R)-6,7-dimethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-1-yl]methyl]phenolate;hydroiodide.
| Compound Name | 4-[[(1R)-6,7-dimethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-1-yl]methyl]phenolate;hydroiodide |
|---|---|
| PubChem CID | 52993803 |
| Molecular Formula | C20H26INO3 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 4-[[(1R)-6,7-dimethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-1-yl]methyl]phenolate;hydroiodide |
| SMILES | COc1cc2c(cc1OC)[C@@H](Cc1ccc([O-])cc1)[N+](C)(C)CC2.I |
| InChI | InChI=1S/C20H25NO3.HI/c1-21(2)10-9-15-12-19(23-3)20(24-4)13-17(15)18(21)11-14-5-7-16(22)8-6-14;/h5-8,12-13,18H,9-11H2,1-4H3;1H/t18-;/m1./s1 |
| InChIKey | YINKCESSROTJJF-GMUIIQOCSA-N |
| XLogP | 3.31 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|