C16H24N2O2 — CID 9170054
(8S)-N,N-dipropyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-8-amine (PubChem CID 9170054) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (8S)-N,N-dipropyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-8-amine.
| Compound Name | (8S)-N,N-dipropyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-8-amine |
|---|---|
| PubChem CID | 9170054 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (8S)-N,N-dipropyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-8-amine |
| SMILES | CCCN(CCC)[C@@H]1CNCc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C16H24N2O2/c1-3-5-18(6-4-2)14-10-17-9-12-7-15-16(8-13(12)14)20-11-19-15/h7-8,14,17H,3-6,9-11H2,1-2H3/t14-/m1/s1 |
| InChIKey | SOFIIUGMBYHZRO-CQSZACIVSA-N |
| XLogP | 2.68 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |