C13H20N2 — CID 9168642
(4R)-N,N-diethyl-1,2,3,4-tetrahydroisoquinolin-4-amine (PubChem CID 9168642) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (4R)-N,N-diethyl-1,2,3,4-tetrahydroisoquinolin-4-amine.
| Compound Name | (4R)-N,N-diethyl-1,2,3,4-tetrahydroisoquinolin-4-amine |
|---|---|
| PubChem CID | 9168642 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (4R)-N,N-diethyl-1,2,3,4-tetrahydroisoquinolin-4-amine |
| SMILES | CCN(CC)[C@H]1CNCc2ccccc21 |
| InChI | InChI=1S/C13H20N2/c1-3-15(4-2)13-10-14-9-11-7-5-6-8-12(11)13/h5-8,13-14H,3-4,9-10H2,1-2H3/t13-/m0/s1 |
| InChIKey | BIIIFPBHTGUANM-ZDUSSCGKSA-N |
| XLogP | 2.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |