C14H19NO2 — CID 64686973
8-ethyl-9-methyl-2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinoline (PubChem CID 64686973) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 8-ethyl-9-methyl-2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinoline.
| Compound Name | 8-ethyl-9-methyl-2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinoline |
|---|---|
| PubChem CID | 64686973 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 8-ethyl-9-methyl-2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinoline |
| SMILES | CCC1NCc2cc3c(cc2C1C)OCCO3 |
| InChI | InChI=1S/C14H19NO2/c1-3-12-9(2)11-7-14-13(16-4-5-17-14)6-10(11)8-15-12/h6-7,9,12,15H,3-5,8H2,1-2H3 |
| InChIKey | VXYZRTCVZGPMOT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |