7,8-dihydrobenzo[f][1,3]benzodioxole-6-carboxylic acid

C12H10O4 — CID 23045021

IUPAC7,8-dihydrobenzo[f][1,3]benzodioxole-6-carboxylic acid
SMILESO=C(O)C1=Cc2cc3c(cc2CC1)OCO3
InChIInChI=1S/C12H10O4/c13-12(14)8-2-1-7-4-10-11(16-6-15-10)5-9(7)3-8/h3-5H,1-2,6H2,(H,13,14)
InChIKeyLVCZIAAQMYAHRB-UHFFFAOYSA-N
MW218.21 g/mol
LogP1.83
Rot. Bonds1

About 7,8-dihydrobenzo[f][1,3]benzodioxole-6-carboxylic acid

7,8-dihydrobenzo[f][1,3]benzodioxole-6-carboxylic acid (PubChem CID 23045021) has the molecular formula C12H10O4 and a molecular weight of 218.21 g/mol. Its IUPAC name is 7,8-dihydrobenzo[f][1,3]benzodioxole-6-carboxylic acid.

Molecular Properties

Compound Name7,8-dihydrobenzo[f][1,3]benzodioxole-6-carboxylic acid
PubChem CID23045021
Molecular FormulaC12H10O4
Molecular Weight218.21 g/mol
Exact Mass218.06
IUPAC Name7,8-dihydrobenzo[f][1,3]benzodioxole-6-carboxylic acid
SMILESO=C(O)C1=Cc2cc3c(cc2CC1)OCO3
InChIInChI=1S/C12H10O4/c13-12(14)8-2-1-7-4-10-11(16-6-15-10)5-9(7)3-8/h3-5H,1-2,6H2,(H,13,14)
InChIKeyLVCZIAAQMYAHRB-UHFFFAOYSA-N
XLogP1.83
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.21
LogP ≤ 51.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 7,8-dihydrobenzo[f][1,3]benzodioxole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7,8-dihydrobenzo[f][1,3]benzodioxole-6-carboxylic acid?
The IUPAC name of 7,8-dihydrobenzo[f][1,3]benzodioxole-6-carboxylic acid (CID 23045021) is 7,8-dihydrobenzo[f][1,3]benzodioxole-6-carboxylic acid.
What is the SMILES notation for 7,8-dihydrobenzo[f][1,3]benzodioxole-6-carboxylic acid?
The canonical SMILES for 7,8-dihydrobenzo[f][1,3]benzodioxole-6-carboxylic acid is O=C(O)C1=Cc2cc3c(cc2CC1)OCO3.
What is the InChIKey of 7,8-dihydrobenzo[f][1,3]benzodioxole-6-carboxylic acid?
The InChIKey is LVCZIAAQMYAHRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O4/c13-12(14)8-2-1-7-4-10-11(16-6-15-10)5-9(7)3-8/h3-5H,1-2,6H2,(H,13,14).
What are the key properties of 7,8-dihydrobenzo[f][1,3]benzodioxole-6-carboxylic acid?
7,8-dihydrobenzo[f][1,3]benzodioxole-6-carboxylic acid has a molecular weight of 218.21 g/mol, XLogP of 1.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydrobenzo[f][1,3]benzodioxole-6-carboxylic acid is sourced from PubChem (CID 23045021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).