C12H10O4 — CID 23045021
7,8-dihydrobenzo[f][1,3]benzodioxole-6-carboxylic acid (PubChem CID 23045021) has the molecular formula C12H10O4 and a molecular weight of 218.21 g/mol. Its IUPAC name is 7,8-dihydrobenzo[f][1,3]benzodioxole-6-carboxylic acid.
| Compound Name | 7,8-dihydrobenzo[f][1,3]benzodioxole-6-carboxylic acid |
|---|---|
| PubChem CID | 23045021 |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 7,8-dihydrobenzo[f][1,3]benzodioxole-6-carboxylic acid |
| SMILES | O=C(O)C1=Cc2cc3c(cc2CC1)OCO3 |
| InChI | InChI=1S/C12H10O4/c13-12(14)8-2-1-7-4-10-11(16-6-15-10)5-9(7)3-8/h3-5H,1-2,6H2,(H,13,14) |
| InChIKey | LVCZIAAQMYAHRB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |