C11H12NO2+ — CID 3397945
6-methyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium (PubChem CID 3397945) has the molecular formula C11H12NO2+ and a molecular weight of 190.22 g/mol. Its IUPAC name is 6-methyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium.
| Compound Name | 6-methyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
|---|---|
| PubChem CID | 3397945 |
| Molecular Formula | C11H12NO2+ |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 6-methyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
| SMILES | C[N+]1=Cc2cc3c(cc2CC1)OCO3 |
| InChI | InChI=1S/C11H12NO2/c1-12-3-2-8-4-10-11(14-7-13-10)5-9(8)6-12/h4-6H,2-3,7H2,1H3/q+1 |
| InChIKey | LGDCROILDUSHQX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|