C20H17BrF3NO2 — CID 139942473
6-methyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium bromide (PubChem CID 139942473) has the molecular formula C20H17BrF3NO2 and a molecular weight of 440.26 g/mol. Its IUPAC name is 6-methyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium bromide.
| Compound Name | 6-methyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium bromide |
|---|---|
| PubChem CID | 139942473 |
| Molecular Formula | C20H17BrF3NO2 |
| Molecular Weight | 440.26 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | 6-methyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium bromide |
| SMILES | C[N+]1=C(C=Cc2ccc(C(F)(F)F)cc2)c2cc3c(cc2CC1)OCO3.[Br-] |
| InChI | InChI=1S/C20H17F3NO2.BrH/c1-24-9-8-14-10-18-19(26-12-25-18)11-16(14)17(24)7-4-13-2-5-15(6-3-13)20(21,22)23;/h2-7,10-11H,8-9,12H2,1H3;1H/q+1;/p-1 |
| InChIKey | PTXKLTMZORBTGD-UHFFFAOYSA-M |
| XLogP | 1.14 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|