C21H21F3INO2 — CID 139942443
6,6-dimethyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium iodide (PubChem CID 139942443) has the molecular formula C21H21F3INO2 and a molecular weight of 503.30 g/mol. Its IUPAC name is 6,6-dimethyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium iodide.
| Compound Name | 6,6-dimethyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium iodide |
|---|---|
| PubChem CID | 139942443 |
| Molecular Formula | C21H21F3INO2 |
| Molecular Weight | 503.30 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | 6,6-dimethyl-5-[2-[4-(trifluoromethyl)phenyl]ethenyl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium iodide |
| SMILES | C[N+]1(C)CCc2cc3c(cc2C1C=Cc1ccc(C(F)(F)F)cc1)OCO3.[I-] |
| InChI | InChI=1S/C21H21F3NO2.HI/c1-25(2)10-9-15-11-19-20(27-13-26-19)12-17(15)18(25)8-5-14-3-6-16(7-4-14)21(22,23)24;/h3-8,11-12,18H,9-10,13H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | IYNYRPOYVSYZFP-UHFFFAOYSA-M |
| XLogP | 1.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|