C16H13ClNO2+ — CID 71764526
6-(4-chlorophenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium (PubChem CID 71764526) has the molecular formula C16H13ClNO2+ and a molecular weight of 286.74 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium.
| Compound Name | 6-(4-chlorophenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
|---|---|
| PubChem CID | 71764526 |
| Molecular Formula | C16H13ClNO2+ |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 6-(4-chlorophenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
| SMILES | Clc1ccc([N+]2=Cc3cc4c(cc3CC2)OCO4)cc1 |
| InChI | InChI=1S/C16H13ClNO2/c17-13-1-3-14(4-2-13)18-6-5-11-7-15-16(20-10-19-15)8-12(11)9-18/h1-4,7-9H,5-6,10H2/q+1 |
| InChIKey | GUGWLMHFVWCRSU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|