C23H25NO5 — CID 141117695
5-[3,5-dimethoxy-4-(3-methylbut-1-enoxy)phenyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline (PubChem CID 141117695) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 5-[3,5-dimethoxy-4-(3-methylbut-1-enoxy)phenyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline.
| Compound Name | 5-[3,5-dimethoxy-4-(3-methylbut-1-enoxy)phenyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline |
|---|---|
| PubChem CID | 141117695 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 5-[3,5-dimethoxy-4-(3-methylbut-1-enoxy)phenyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline |
| SMILES | COc1cc(C2=NCCc3cc4c(cc32)OCO4)cc(OC)c1OC=CC(C)C |
| InChI | InChI=1S/C23H25NO5/c1-14(2)6-8-27-23-20(25-3)10-16(11-21(23)26-4)22-17-12-19-18(28-13-29-19)9-15(17)5-7-24-22/h6,8-12,14H,5,7,13H2,1-4H3 |
| InChIKey | NECVXTTYPLFPSE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|