C20H23NO5 — CID 44625349
1-(3,4-dimethoxyphenyl)-6,7,8-trimethoxy-3,4-dihydroisoquinoline (PubChem CID 44625349) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-6,7,8-trimethoxy-3,4-dihydroisoquinoline.
| Compound Name | 1-(3,4-dimethoxyphenyl)-6,7,8-trimethoxy-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 44625349 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-6,7,8-trimethoxy-3,4-dihydroisoquinoline |
| SMILES | COc1ccc(C2=NCCc3cc(OC)c(OC)c(OC)c32)cc1OC |
| InChI | InChI=1S/C20H23NO5/c1-22-14-7-6-13(11-15(14)23-2)18-17-12(8-9-21-18)10-16(24-3)19(25-4)20(17)26-5/h6-7,10-11H,8-9H2,1-5H3 |
| InChIKey | VJQJTMLKKJMRDJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |