C18H19NO3 — CID 626628
6,7-dimethoxy-1-(3-methoxyphenyl)-3,4-dihydroisoquinoline (PubChem CID 626628) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 6,7-dimethoxy-1-(3-methoxyphenyl)-3,4-dihydroisoquinoline.
| Compound Name | 6,7-dimethoxy-1-(3-methoxyphenyl)-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 626628 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 6,7-dimethoxy-1-(3-methoxyphenyl)-3,4-dihydroisoquinoline |
| SMILES | COc1cccc(C2=NCCc3cc(OC)c(OC)cc32)c1 |
| InChI | InChI=1S/C18H19NO3/c1-20-14-6-4-5-13(9-14)18-15-11-17(22-3)16(21-2)10-12(15)7-8-19-18/h4-6,9-11H,7-8H2,1-3H3 |
| InChIKey | OGVNHOMELRLNEM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |