C12H16N2O2 — CID 16637178
(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methanamine (PubChem CID 16637178) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is (6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methanamine.
| Compound Name | (6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methanamine |
|---|---|
| PubChem CID | 16637178 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methanamine |
| SMILES | COc1cc2c(cc1OC)C(CN)=NCC2 |
| InChI | InChI=1S/C12H16N2O2/c1-15-11-5-8-3-4-14-10(7-13)9(8)6-12(11)16-2/h5-6H,3-4,7,13H2,1-2H3 |
| InChIKey | YPVRKHBGTZZSFT-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |