C13H16ClNO2 — CID 12018662
1-(chloromethyl)-7,8-dimethoxy-4,5-dihydro-3H-2-benzazepine (PubChem CID 12018662) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is 1-(chloromethyl)-7,8-dimethoxy-4,5-dihydro-3H-2-benzazepine.
| Compound Name | 1-(chloromethyl)-7,8-dimethoxy-4,5-dihydro-3H-2-benzazepine |
|---|---|
| PubChem CID | 12018662 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 1-(chloromethyl)-7,8-dimethoxy-4,5-dihydro-3H-2-benzazepine |
| SMILES | COc1cc2c(cc1OC)C(CCl)=NCCC2 |
| InChI | InChI=1S/C13H16ClNO2/c1-16-12-6-9-4-3-5-15-11(8-14)10(9)7-13(12)17-2/h6-7H,3-5,8H2,1-2H3 |
| InChIKey | GGQAOPLDEVCKSA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|